Home
Products
Ethyl ferulate
| Product Name | Ethyl ferulate |
| Price: | $15 / 20mg |
| Catalog No.: | CN07003 |
| CAS No.: | 4046-02-0 |
| Molecular Formula: | C12H14O4 |
| Molecular Weight: | 222.24 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Ferula sinkiangensis K.M.Shen |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCOC(=O)C=Cc1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ethyl ferulate, a naturally lipophilic derivative of ferulic acid originally derived from giant fennel (F. communis), induces heme oxygenase-1 (HO-1) and protects rat neurons against oxidative stress[1]. Ethyl ferulate also protects neurons against amyloid β peptide (1-42)-induced oxidative stress and neurotoxicity[2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 382.3±0.0 °C at 760 mmHg |
| Flash Point | 132.5±17.2 °C |
| Exact Mass | 222.089203 |
| PSA | 55.76000 |
| LogP | 1.94 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |