Home
Products
Deacetylcinobufagin
| Product Name | Deacetylcinobufagin |
| Price: | $321 / 5mg |
| Catalog No.: | CN02442 |
| CAS No.: | 4026-95-3 |
| Molecular Formula: | C24H32O5 |
| Molecular Weight: | 400.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The glandular body of Bufo bufo gargarizans Cantor. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2([C@@H](C1)CC[C@@H]1[C@@H]2CC[C@]2([C@]31O[C@@H]3[C@@H]([C@@H]2c1ccc(=O)oc1)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Desacetylcinobufagin is a natural compound used for microbial transformation. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 601.9±55.0 °C at 760 mmHg |
| Flash Point | 208.1±25.0 °C |
| Exact Mass | 400.224976 |
| PSA | 83.20000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |
| Storage condition | -20°C |