Home
Products
Acetylcimigenol 3-O-alpha-L-arabinopyranside
| Product Name | Acetylcimigenol 3-O-alpha-L-arabinopyranside |
| Price: | Inquiry |
| Catalog No.: | CN07559 |
| CAS No.: | 402513-88-6 |
| Molecular Formula: | C37H58O10 |
| Molecular Weight: | 662.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Cimicifuga foetida L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@@H]([C@@H]1OC1(C)C)C[C@H]([C@H]1C(=O)[C@@H]([C@@]2([C@]1(C)CC[C@@]13[C@H]2CC[C@@H]2[C@]3(C1)CC[C@@H](C2(C)C)O[C@@H]1OC[C@@H]([C@@H]([C@H]1O)O)O)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Acetylshengmanol Arabinoside is isolated from Cimicifugae rhizoma. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 748.5±60.0 °C at 760 mmHg |
| Flash Point | 225.6±26.4 °C |
| Exact Mass | 662.403015 |
| PSA | 155.28000 |
| LogP | 4.14 |
| Vapour Pressure | 0.0±5.7 mmHg at 25°C |