Home
Products
Glycitin
| Product Name | Glycitin |
| Price: | $37 / 20mg |
| Catalog No.: | CN05560 |
| CAS No.: | 40246-10-4 |
| Molecular Formula: | C22H22O10 |
| Molecular Weight: | 446.41 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Glycine max (L.) Merr. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2cc3occ(c(=O)c3cc2OC)c2ccc(cc2)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Glycitin is a natural isoflavone isolated from legumes; promotes the proliferation of bone marrow stromal cells and osteoblasts and suppresses bone turnover. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 751.1±60.0 °C at 760 mmHg |
| Flash Point | 264.1±26.4 °C |
| Exact Mass | 446.121307 |
| PSA | 159.05000 |
| LogP | 0.16 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Storage condition | Store at -20 |