Home
Products
5-O-Feruloylquinic acid
| Product Name | 5-O-Feruloylquinic acid |
| Price: | $380 / 5mg |
| Catalog No.: | CN06851 |
| CAS No.: | 40242-06-6 |
| Molecular Formula: | C17H20O9 |
| Molecular Weight: | 368.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Coffea canephorra var. Robusta |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1cc(C=CC(=O)O[C@@H]2C[C@](O)(C[C@H]([C@@H]2O)O)C(=O)O)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5-Feruloylquinic acid (5-FQA) possesses antioxidative effects and tyrosinase inhibitory activities[1]. |
| Exact Mass | 368.11100 |
| PSA | 153.75000 |