Home
Products
p-Hydroxy-5,6-dehydrokawain
| Product Name | p-Hydroxy-5,6-dehydrokawain |
| Price: | $380 / 10mg |
| Catalog No.: | CN03833 |
| CAS No.: | 39986-86-2 |
| Molecular Formula: | C14H12O4 |
| Molecular Weight: | 244.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Piper methysticum Forst |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(/C=C/c2ccc(cc2)O)oc(=O)c1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | p-Hydroxy-5,6-dehydrokawain is a natural compound isolated from Kawain[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 493.0±45.0 °C at 760 mmHg |
| Flash Point | 192.7±22.2 °C |
| Exact Mass | 244.073563 |
| PSA | 59.67000 |
| LogP | 1.26 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |