Home
Products
Sinigrin
| Product Name | Sinigrin |
| Price: | $131 / 20mg |
| Catalog No.: | CN01294 |
| CAS No.: | 3952-98-5 |
| Molecular Formula: | C10H16KNO9S2 |
| Molecular Weight: | 397.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The seeds of Lepidium apetalum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | C=CC/C(=NOS(=O)(=O)[O-])/S[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O.O.[K+] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sinigrin is a major glucosinolate present in plants of the Brassicaceae family, with anti-adipogenic effects[1]. |
| Exact Mass | 415.000916 |
| PSA | 202.62000 |