Home
Products
Kamebanin
| Product Name | Kamebanin |
| Price: | Inquiry |
| Catalog No.: | CN08827 |
| CAS No.: | 39388-57-3 |
| Molecular Formula: | C20H30O4 |
| Molecular Weight: | 334.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rabdosia excisa (Maxim.)Hara |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1[C@@H]2CC[C@@H]3[C@](C1=O)([C@@H]2O)[C@H](O)C[C@H]1[C@@]3(C)[C@@H](O)CCC1(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kamebanin can be isolated from the leaves of Isodon weisiensis C. Y. Wu. Kamebanin has anti-proliferative activity and can be used in cancer research[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 514.0±50.0 °C at 760 mmHg |
| Flash Point | 278.8±26.6 °C |
| Exact Mass | 334.214417 |
| PSA | 77.76000 |
| LogP | 1.46 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |