Home
Products
Karacoline
| Product Name | Karacoline |
| Price: | Inquiry |
| Catalog No.: | CN00766 |
| CAS No.: | 39089-30-0 |
| Molecular Formula: | C22H35NO4 |
| Molecular Weight: | 377.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum kusnezoffii Reichb. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCN1C[C@]2(C)CC[C@@H]([C@]34C1[C@H](C[C@H]23)[C@@]1(O)C[C@@H]([C@H]2C[C@@H]4[C@@H]1[C@H]2O)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Karacoline, a diterpene alkaloid found in the plant Aconitum kusnezoffii, reduces degradation of the extracellular matrix (ECM) in intervertebral disc degeneration (IDD) via the NF-κB signaling pathway[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 540.2±50.0 °C at 760 mmHg |
| Flash Point | 280.5±30.1 °C |
| Exact Mass | 377.256622 |
| PSA | 73.16000 |
| LogP | -0.26 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |