Home
Products
Trioxsalen
| Product Name | Trioxsalen |
| Price: | Inquiry |
| Catalog No.: | CN06033 |
| CAS No.: | 3902-71-4 |
| Molecular Formula: | C14H12O3 |
| Molecular Weight: | 228.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Parsnip. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Cc1cc2c(o1)c(C)c1c(c2)c(C)cc(=O)o1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Trioxsalen is a furanocoumarin and a psoralen derivative, in conjunction with UV-A for phototherapy treatment of vitiligo and hand eczema. After photoactivation it creates interstrand cross-links in DNA, which can cause programmed cell death. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 389.0±30.0 °C at 760 mmHg |
| Flash Point | 189.1±24.6 °C |
| Exact Mass | 228.078644 |
| PSA | 43.35000 |
| LogP | 3.80 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Storage condition | 2-8°C |