Home
Products
Picroside II
| Product Name | Picroside II |
| Price: | $46 / 20mg |
| Catalog No.: | CN03174 |
| CAS No.: | 39012-20-9 |
| Molecular Formula: | C23H28O13 |
| Molecular Weight: | 512.47 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | White powder |
| Source: | The roots of Picrorhiza scrophulariiflora |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2OC=CC3C2C2(CO)OC2C3OC(=O)c2ccc(c(c2)OC)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Picroside II, an iridoid compound extracted from Picrorhiza, exhibits anti-inflammatory and anti-apoptotic activities. picroside II alleviates the inflammatory response in sepsis and enhances immune function by inhibiting the activation of NLRP3 inflammasome and NF-κB pathways[1]. Picroside II is an antioxidant, exhibits a significant neuroprotective effect through reducing ROS production and protects the blood-brain barrier (BBB) after cerebral ischemia-reperfusion (CI/R) injury[2]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 780.8±60.0 °C at 760 mmHg |
| Flash Point | 267.9±26.4 °C |
| Exact Mass | 512.153015 |
| PSA | 197.13000 |
| LogP | -2.50 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Storage condition | 2-8°C |