Home
Products
Epimedoside A
| Product Name | Epimedoside A |
| Price: | $409 / 10mg |
| Catalog No.: | CN04858 |
| CAS No.: | 39012-04-9 |
| Molecular Formula: | C32H38O15 |
| Molecular Weight: | 662.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Epimedium brevicornum Maxim. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2cc(O)c3c(c2CC=C(C)C)oc(c(c3=O)OC2OC(C)C(C(C2O)O)O)c2ccc(cc2)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Epimedoside A is a flavonoid isolated from the roots of Epimedium wushanense. Epimedoside A exhibits significant antioxidant activity in vitro[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 971.5±65.0 °C at 760 mmHg |
| Flash Point | 310.9±27.8 °C |
| Exact Mass | 662.221069 |
| PSA | 249.20000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |