Home
Products
Oxypaeoniflorin
| Product Name | Oxypaeoniflorin |
| Price: | $92 / 10mg |
| Catalog No.: | CN09684 |
| CAS No.: | 39011-91-1 |
| Molecular Formula: | C23H28O12 |
| Molecular Weight: | 496.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Paeonia lactiflora Pall. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@]23C[C@@H]4[C@@]3(COC(=O)c3ccc(cc3)O)[C@@H]3O[C@@]2(C)C[C@]4(O3)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Oxypaeoniflorin is a natural product derived from Radix Paeoniae Rubra and Radix Paeoniae Alba. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 737.1±60.0 °C at 760 mmHg |
| Flash Point | 254.6±26.4 °C |
| Exact Mass | 496.158081 |
| PSA | 184.60000 |
| LogP | -0.17 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Storage condition | -20°C |