Home
Products
Raspberryketone glucoside
| Product Name | Raspberryketone glucoside |
| Price: | $46 / 20mg |
| Catalog No.: | CN03452 |
| CAS No.: | 38963-94-9 |
| Molecular Formula: | C16H22O7 |
| Molecular Weight: | 326.34 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The fruits of red raspberry (Rubus idaeus). |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2)CCC(=O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Raspberry ketone glucoside is a natural product in raspberry fruit. Raspberry ketone glucosidev has the inhibitory effect on the melanin synthesis[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 553.8±50.0 °C at 760 mmHg |
| Flash Point | 202.8±23.6 °C |
| Exact Mass | 326.136566 |
| PSA | 116.45000 |
| LogP | -1.22 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |