Home
Products
Piperlotine A
| Product Name | Piperlotine A |
| Price: | $439 / 10mg |
| Catalog No.: | CN01010 |
| CAS No.: | 389572-70-7 |
| Molecular Formula: | C14H17NO2 |
| Molecular Weight: | 231.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Piper nigrum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)/C=C/C(=O)N1CCCC1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Piperlotine A is an alkaloid isolated from Piper lolot, with potent antiplatelet aggregation activity[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 436.0±24.0 °C at 760 mmHg |
| Flash Point | 217.5±22.9 °C |
| Exact Mass | 231.125931 |
| PSA | 29.54000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |