Home
Products
Isodeoxyelephantopin
| Product Name | Isodeoxyelephantopin |
| Price: | $219 / 5mg |
| Catalog No.: | CN09362 |
| CAS No.: | 38927-54-7 |
| Molecular Formula: | C19H20O6 |
| Molecular Weight: | 344.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Elephantopus scaber Linn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=C[C@H]2OC(=O)C(=C)[C@@H]2[C@H](CC2=C[C@H](C1)OC2=O)OC(=O)C(=C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isodeoxyelephantopin is a sesquiterpene lactone isolated from Elephantopus scaber. Isodeoxyelephantopin induces ROS generation, suppresses NF-κB activation. Isodeoxyelephantopin also modulates LncRNA expression and exhibit activities against breast cancer[1][2]. |
| In Vitro | Isodeoxyelephantopin induces protective autophagy in lung cancer cells via Nrf2-p62-keap1 feedback loop. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 584.3±50.0 °C at 760 mmHg |
| Flash Point | 258.1±30.2 °C |
| Exact Mass | 344.125977 |
| PSA | 78.90000 |
| LogP | 1.51 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | ?20°C |