Home
Products
Emodin 1-O-beta-D-glucoside
| Product Name | Emodin 1-O-beta-D-glucoside |
| Price: | $249 / 10mg |
| Catalog No.: | CN05940 |
| CAS No.: | 38840-23-2 |
| Molecular Formula: | C21H20O10 |
| Molecular Weight: | 432.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | The roots and rhizomes of Rheum palmatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)cc3c2C(=O)c2c(C3)cccc2O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Emodin-1-O-β-D-glucopyranoside, isolated from medicinal plant Polygonum cuspidatum Sieb. & Zucc, is a potent and noncompetitive bacterial neuraminidase (BNA) inhibitor with an IC50 of 0.85 μM[1]. |
| Target | IC50: 0.85 μM (BNA)[1] |
| Density | 1.667±0.06 g/cm3 |
| Exact Mass | 432.10600 |
| PSA | 173.98000 |
| Storage condition | 2-8℃ |