Home
Products
Epibetulinic acid
| Product Name | Epibetulinic acid |
| Price: | $234 / 20mg |
| Catalog No.: | CN07265 |
| CAS No.: | 38736-77-5 |
| Molecular Formula: | C30H48O3 |
| Molecular Weight: | 456.71 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Ziziphus jujuba |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=C)C1CCC2(C1C1CCC3C(C1(C)CC2)(C)CCC1C3(C)CCC(C1(C)C)O)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Epibetulinic acid, isolated from the root bark of Maytenus cuzcoina and the leaves of Maytenus chiapensis, exhibits potent inhibitory effects on NO and prostaglandin E2 (PGE2) production in mouse macrophages (RAW 264.7) stimulated with bacterial endotoxin with IC50s of 0.7 and 0.6 μM, respectively. Anti-inflammatory activity[1]. |
| Target | PGE2:0.6 μM (IC50) NO:0.7 μM (IC50) |
| Density | 1.1±0.0 g/cm3 |
| Boiling Point | 550.0±0.0 °C at 760 mmHg |
| Flash Point | 300.5±0.0 °C |
| Exact Mass | 456.360352 |
| PSA | 57.53000 |
| LogP | 8.94 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
| Storage condition | 2-8C |