Home
Products
Neodiosmin
| Product Name | Neodiosmin |
| Price: | $37 / 20mg |
| Catalog No.: | CN04519 |
| CAS No.: | 38665-01-9 |
| Molecular Formula: | C28H32O15 |
| Molecular Weight: | 608.54 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Citrus aurantium |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2cc(O)c3c(c2)oc(cc3=O)c2ccc(c(c2)O)OC)C(C(C1O)O)OC1OC(C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Neodiosmin is a flavone glycoside isolated from the leaves of Citrus aurantium[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 930.4±65.0 °C at 760 mmHg |
| Flash Point | 306.4±27.8 °C |
| Exact Mass | 608.174133 |
| PSA | 238.20000 |
| LogP | 2.71 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |