Home
Products
Triptonide
| Product Name | Triptonide |
| Price: | $92 / 10mg |
| Catalog No.: | CN08918 |
| CAS No.: | 38647-11-9 |
| Molecular Formula: | C20H22O6 |
| Molecular Weight: | 358.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Tripterygium wilfordii Hook.f. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1OCC2=C1CC[C@]1([C@H]2C[C@H]2[C@@]3([C@@]41O[C@H]4[C@@H]1O[C@@]1(C3=O)C(C)C)O2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Triptonide(NSC 165677; PG 492), extracted from Tripterygium wilfordii Hook, inhibited the proliferation of mouse splenocytes induced by suboptimal concentration of concanavalin A or lipopolysaccharide at concentrations of 0.02, 0.1, and 0.5 mg/ml. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 581.1±50.0 °C at 760 mmHg |
| Flash Point | 257.8±30.2 °C |
| Exact Mass | 358.141632 |
| PSA | 80.96000 |
| LogP | 1.49 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | 2-8°C |