Home
Products
Benzoylpaeoniflorin
| Product Name | Benzoylpaeoniflorin |
| Price: | $85 / 20mg |
| Catalog No.: | CN09689 |
| CAS No.: | 38642-49-8 |
| Molecular Formula: | C30H32O12 |
| Molecular Weight: | 584.57 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | White cryst. |
| Source: | The roots of Paeonia lactiflora Pall. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@H]1[C@@H](O[C@@H]([C@H]([C@@H]1O)O)COC(=O)c1ccccc1)O[C@@]12C[C@@H]3[C@@]2(COC(=O)c2ccccc2)[C@@H]2O[C@@]1(C)C[C@]3(O2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Benzoylpaeoniflorin is a natural product; may treat coronary heart disease by decreasing apoptosis. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 742.9±60.0 °C at 760 mmHg |
| Flash Point | 243.1±26.4 °C |
| Exact Mass | 584.189392 |
| PSA | 170.44000 |
| LogP | 5.55 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |