Home
Products
Aloenin A
| Product Name | Aloenin A |
| Price: | Inquiry |
| Catalog No.: | CN03450 |
| CAS No.: | 38412-46-3 |
| Molecular Formula: | C19H22O10 |
| Molecular Weight: | 410.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Aloe vera |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)cc(c2c2cc(OC)cc(=O)o2)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aloenin (Aloenin A) is a class of anthraquinones isolated from Aloe arborescens. Aloenin has potent peroxyl radical-scavenging activities and moderate inhibitory active on β-secretase (BACE)[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 787.8±60.0 °C at 760 mmHg |
| Flash Point | 282.2±26.4 °C |
| Exact Mass | 410.121307 |
| PSA | 159.05000 |
| LogP | -0.48 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Storage condition | ?20°C |