Home
Products
Caudatin
| Product Name | Caudatin |
| Price: | $176 / 20mg |
| Catalog No.: | CN02606 |
| CAS No.: | 38395-02-7 |
| Molecular Formula: | C28H42O7 |
| Molecular Weight: | 490.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The roots of Cynanchum otophyllum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(O[C@@H]1C[C@@H]2[C@@]3(C)CC[C@@H](CC3=CC[C@]2([C@@]2([C@@]1(C)[C@](O)(CC2)C(=O)C)O)O)O)/C=C(/C(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Caudatin is a steroidal cmpound found in Cynanchum auriculatum, causes cell cycle arrest and induces apoptosis, with anti-cancer and antiangiogenic properties[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 617.9±55.0 °C at 760 mmHg |
| Flash Point | 197.5±25.0 °C |
| Exact Mass | 490.293060 |
| PSA | 124.29000 |
| LogP | 4.37 |
| Vapour Pressure | 0.0±4.1 mmHg at 25°C |
| Storage condition | 2-8C |