Home
Products
Naringenin trimethyl ether
| Product Name | Naringenin trimethyl ether |
| Price: | $234 / 10mg |
| Catalog No.: | CN05381 |
| CAS No.: | 38302-15-7 |
| Molecular Formula: | C18H18O5 |
| Molecular Weight: | 314.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Potentilla discolor Bunge |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)[C@@H]1CC(=O)c2c(O1)cc(cc2OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Naringenin trimethyl ether is a constituent of twigs and leaves of Aglaia duperreana. Naringenin trimethyl exhibits significant molluscicidal activity, with a LC50 of 3.9 μg/ mL for P. canaliculata[1]. |
| Target | LC50: 3.9 μg/ mL (P. canaliculata)[1] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 500.1±50.0 °C at 760 mmHg |
| Flash Point | 222.1±30.2 °C |
| Exact Mass | 314.115417 |
| PSA | 53.99000 |
| LogP | 3.46 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |