Home
Products
Anhydroicaritin
| Product Name | Anhydroicaritin |
| Price: | $46 / 20mg |
| Catalog No.: | CN05395 |
| CAS No.: | 38226-86-7 |
| Molecular Formula: | C21H20O6 |
| Molecular Weight: | 368.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Epimedium brevicornu Maxim |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1oc2c3CCC(Oc3cc(c2c(=O)c1O)O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | β-Anhydroicaritin is isolated from Boswellia carterii Birdware, has important biological and pharmacological effects, such as antiosteoporosis, estrogen regulation and antitumor properties[1][2]. β-Anhydroicaritin decreases the overproduction of NO, IL-10, TNF-α, MCP-1 and IL-6 in inperitonitis mice. β-Anhydroicaritin inhibits the elevation of intracellular Ca2+, and markedly decreases iNOS protein expression[3]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 575.3±50.0 °C at 760 mmHg |
| Flash Point | 205.5±23.6 °C |
| Exact Mass | 368.125977 |
| PSA | 89.13000 |
| LogP | 5.04 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |