Home
Products
Filixic acid ABA
| Product Name | Filixic acid ABA |
| Price: | Inquiry |
| Catalog No.: | CN04105 |
| CAS No.: | 38226-84-5 |
| Molecular Formula: | C32H36O12 |
| Molecular Weight: | 612.63 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Yellow powder |
| Source: | The rhizomes of Dryopteris crassirhizoma Nakai |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CCCC(=O)c1c(O)c(CC2=C(O)C(C(=O)C(=C2O)C(=O)C)(C)C)c(c(c1O)CC1=C(O)C(C(=O)C(=C1O)C(=O)C)(C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Filixic acid ABA is a molluscicidal agent against B. peregrina adult snails, with an LD50 of 8.40 ppm. Filixic acid ABA shows 100% mortality of B. peregrina at 15 ppm[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 900.5±65.0 °C at 760 mmHg |
| Flash Point | 512.2±30.8 °C |
| Exact Mass | 612.220703 |
| PSA | 226.96000 |
| LogP | 5.17 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |