Home
Products
Coumarin VI
| Product Name | Coumarin VI |
| Price: | $23 / 20mg |
| Catalog No.: | CN06078 |
| CAS No.: | 38215-36-0 |
| Molecular Formula: | C20H18N2O2S |
| Molecular Weight: | 350.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCN(c1ccc2c(c1)oc(=O)c(c2)c1nc2c(s1)cccc2)CC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Coumarin 6, a fluorescent dye, is used as a fluorescent probe in a microparticle drug delivery system to conduct in vivo tracking, cell uptake, and transport mechanism studies of drug delivery systems[1]. |
| Density | 1.311 g/cm3 |
| Boiling Point | 570.1ºC at 760 mmHg |
| Flash Point | 298.6ºC |
| Exact Mass | 350.10900 |
| PSA | 74.58000 |
| LogP | 4.91590 |