Home
Products
7,8-Dihydroxyflavone
| Product Name | 7,8-Dihydroxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN04723 |
| CAS No.: | 38183-03-8 |
| Molecular Formula: | C15H10O4 |
| Molecular Weight: | 254.24 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Pueraria lobata (Willd) Ohwi |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1O)oc(cc2=O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7,8-Dihydroxyflavone is a potent and selective TrkB agonist that mimics the physiological actions of Brain-derived neurotrophic factor (BDNF). Displays therapeutic efficacy toward various neurological diseases[1]. |
| Target | TrkB[1] |
| In Vitro | 7,8-Dihydroxyflavone (500 nM) protects the primary cortical neurons and locus coeruleus (LC) neurons from Aβ-induced toxicity and promotes dendritic growth and synaptogenesis[1]. |
| In Vivo | 7,8-Dihydroxyflavone (5 mg/kg/day) prevents synaptic loss and memory deficits in a mouse model of Alzheimer’s Disease[1]. Administration of 7,8- dihydroxyflavone to mice activates TrkB in the brain, inhibits kainic acid-induced toxicity, decreases infarct volumes in stroke in a TrkBdependent manner, and is neuroprotective in an animal model of Parkinson disease[2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 494.4±45.0 °C at 760 mmHg |
| Flash Point | 193.5±22.2 °C |
| Exact Mass | 254.057907 |
| PSA | 70.67000 |
| LogP | 2.51 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | Store at +4°C |