Home
Products
Brevianamide F
| Product Name | Brevianamide F |
| Price: | Inquiry |
| Catalog No.: | CN00889 |
| CAS No.: | 38136-70-8 |
| Molecular Formula: | C16H17N3O2 |
| Molecular Weight: | 283.33 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The fermentation broth of Streptomyces sp. strain TN58. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1N[C@@H](Cc2c[nH]c3c2cccc3)C(=O)N2[C@H]1CCC2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Brevianamide F , also known as cyclo-(L-Trp-L-Pro), belongs to a class of naturally occurring 2,5-diketopiperazines.Brevianamide F possess interesting breast cancer resistance protein inhibitory activity.[1] brevianamide F once used as aromatic substrate. [2] |
| Boiling Point | 633.2°C |
| Exact Mass | 283.13200 |
| PSA | 68.69000 |
| LogP | 1.41360 |
| Storage condition | 2-8°C |