Home
Products
Bosutinib (SKI-606)
| Product Name | Bosutinib (SKI-606) |
| Price: | Inquiry |
| Catalog No.: | CN00410 |
| CAS No.: | 380843-75-4 |
| Molecular Formula: | C26H29Cl2N5O3 |
| Molecular Weight: | 530.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c(cc1OCCCN1CCN(CC1)C)ncc(c2Nc1cc(OC)c(cc1Cl)Cl)C#N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bosutinib is a dual Src/Abl inhibitor with IC50s of 1.2 nM and 1 nM, respectively. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 649.7±55.0 °C at 760 mmHg |
| Flash Point | 346.7±31.5 °C |
| Exact Mass | 529.164734 |
| PSA | 82.88000 |
| LogP | 5.48 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Storage condition | room temp |