Home
Products
Columbianetin
| Product Name | Columbianetin |
| Price: | $204 / 10mg |
| Catalog No.: | CN06213 |
| CAS No.: | 3804-70-4 |
| Molecular Formula: | C14H14O4 |
| Molecular Weight: | 246.26 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | White powder |
| Source: | The roots of Angelica pubescens. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1ccc2c(o1)c1C[C@H](Oc1cc2)C(O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Columbianetin is a phytoalexin associated with celery (Apium graveolens) resistance to pathogens during storage. Columbianetin exhibits excellent anti-fungal and anti-inflammatory activity[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 443.0±45.0 °C at 760 mmHg |
| Flash Point | 171.9±22.2 °C |
| Exact Mass | 246.089203 |
| PSA | 59.67000 |
| LogP | 1.69 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | 2-8C |