Home
Products
Cimifugin
| Product Name | Cimifugin |
| Price: | $62 / 20mg |
| Catalog No.: | CN05382 |
| CAS No.: | 37921-38-3 |
| Molecular Formula: | C16H18O6 |
| Molecular Weight: | 306.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Saposhnikovia divaricata (Turcz.) Schischk. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c2C[C@H](Oc2cc2c1c(=O)cc(o2)CO)C(O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cimifugin is a major components of Yu-ping-feng-san, a Chinese medical formula that is used clinically for allergic diseases and characterized by reducing allergy relapse. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 546.4±50.0 °C at 760 mmHg |
| Flash Point | 204.9±23.6 °C |
| Exact Mass | 306.110352 |
| PSA | 89.13000 |
| LogP | 1.21 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | -20°C |