Home
Products
Jolkinolide B
| Product Name | Jolkinolide B |
| Price: | $260 / 10mg |
| Catalog No.: | CN08714 |
| CAS No.: | 37905-08-1 |
| Molecular Formula: | C20H26O4 |
| Molecular Weight: | 330.42 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Stellera chamaejasme Linn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1O[C@@]23C(=C1C)[C@H]1O[C@]41[C@@H]([C@H]3O2)[C@]1(C)CCCC([C@H]1CC4)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Jolkinolide B, a bioactive diterpene isolated from the roots of Euphorbia fischeriana Steud, is known to induce apoptosis in cancer cells[1]. |
| Target | IC50: apoptosis[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 497.1±45.0 °C at 760 mmHg |
| Flash Point | 219.8±28.8 °C |
| Exact Mass | 330.183105 |
| PSA | 51.36000 |
| LogP | 3.24 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8℃ |