Home
Products
Cimigenol
| Product Name | Cimigenol |
| Price: | Inquiry |
| Catalog No.: | CN07239 |
| CAS No.: | 3779-59-7 |
| Molecular Formula: | C30H48O5 |
| Molecular Weight: | 488.70 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Cimicifuga dahurica. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1C[C@H]2O[C@]3([C@H]1[C@@]1(C)CC[C@@]45[C@H]([C@@]1([C@H]3O)C)CC[C@@H]1[C@]5(C4)CC[C@@H](C1(C)C)O)O[C@H]2C(O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cimigenol is an active compound isolated from Cimicifuga, with potent anti-tumor activity[1]. |
| Density | 1.22g/cm3 |
| Boiling Point | 610.6ºC at 760mmHg |
| Flash Point | 323.1ºC |
| Exact Mass | 488.35000 |
| PSA | 79.15000 |
| LogP | 4.65810 |