Home
Products
Varenicline tartrate
| Product Name | Varenicline tartrate |
| Price: | Inquiry |
| Catalog No.: | CN02010 |
| CAS No.: | 375815-87-5 |
| Molecular Formula: | C13H13N3.C4H6O6 |
| Molecular Weight: | 361.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | N1C[C@@H]2C[C@H](C1)c1c2cc2c(c1)nccn2.O[C@H]([C@H](C(=O)O)O)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Varenicline Tartrate(CP 526555;Champix) is a nicotinic receptor partial agonist; it stimulates nicotine receptors more weakly than nicotine itself does.IC50 value:Target: α4β2 nAChRVarenicline(CP 526555; Champix; Chantix) is a prescription medication used to treat smoking addiction. As a partial agonist it both reduces cravings for and decreases the pleasurable effects of cigarettes and other tobacco products. Through these mechanisms Varenicline(CP 526555; Champix; Chantix) can assist some patients to quit smoking. |
| Boiling Point | 400.6ºC at 760 mmHg |
| PSA | 23.79000 |
| LogP | 4.49528 |
| Storage condition | Desiccate at RT |