Home
Products
Sennoside C
| Product Name | Sennoside C |
| Price: | $204 / 5mg |
| Catalog No.: | CN05993 |
| CAS No.: | 37271-16-2 |
| Molecular Formula: | C42H40O19 |
| Molecular Weight: | 848.76 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow powder |
| Source: | The leaves of Cassia angustifolia. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCc1cc(O)c2c(c1)C(C1c3cccc(c3C(=O)c3c1cc(cc3O)C(=O)O)OC1OC(CO)C(C(C1O)O)O)c1c(C2=O)c(ccc1)OC1OC(CO)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sennoside C is an anthraquinone glycoside, found in leaves and pods of Senna (Cassia angustifolia)[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 1130.3±65.0 °C at 760 mmHg |
| Flash Point | 344.4±27.8 °C |
| Exact Mass | 848.216370 |
| PSA | 330.89000 |
| LogP | 0.68 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8°C |