Home
Products
Wilfordine
| Product Name | Wilfordine |
| Price: | Inquiry |
| Catalog No.: | CN09338 |
| CAS No.: | 37239-51-3 |
| Molecular Formula: | C43H49NO19 |
| Molecular Weight: | 883.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Tripterygium wilfordii Hook. f. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OCC12C(OC(=O)C)C(OC(=O)c3ccccc3)C3C(C42OC(C(C(C1OC(=O)C)OC(=O)C)C4OC(=O)C)(C)COC(=O)c1cccnc1CCC(C(=O)O3)(C)O)(C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Wilfordine is an alkaloid that isolated from the roots of Tripterygium wilfordii[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 895.5±65.0 °C at 760 mmHg |
| Flash Point | 495.4±34.3 °C |
| Exact Mass | 883.289856 |
| PSA | 272.98000 |
| LogP | 5.05 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8°C |