Home
Products
Wilforgine
| Product Name | Wilforgine |
| Price: | $176 / 10mg |
| Catalog No.: | CN09441 |
| CAS No.: | 37239-47-7 |
| Molecular Formula: | C41H47NO19 |
| Molecular Weight: | 857.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Tripterygium wilfordii Hook. f. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC[C@]12[C@@H](OC(=O)C)[C@@H](OC(=O)c3ccoc3)[C@H]3[C@]([C@@]42OC(C([C@H]([C@H]1OC(=O)C)OC(=O)C)[C@H]4OC(=O)C)(C)COC(=O)c1cccnc1CC[C@@H](C(=O)O3)C)(C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Wilforgine is a bioactive sesquiterpene alkaloid in Tripterygium wilfordii Hook. F. Wilforgine can induce microstructural and ultrastructural changes in the muscles of Mythimna separata larvae, and the sites of action are proposed to be calcium receptors or channels in the muscular system[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 859.9±65.0 °C at 760 mmHg |
| Flash Point | 473.8±34.3 °C |
| Exact Mass | 857.274231 |
| PSA | 265.89000 |
| LogP | 5.32 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8C |