Home
Products
Procyanidin C1
| Product Name | Procyanidin C1 |
| Price: | $117 / 5mg |
| Catalog No.: | CN05524 |
| CAS No.: | 37064-30-5 |
| Molecular Formula: | C45H38O18 |
| Molecular Weight: | 866.77 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vitis vinifera L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc(O)c2c(c1)O[C@@H]([C@@H]([C@H]2c1c(O)cc(c2c1O[C@H](c1ccc(c(c1)O)O)[C@@H]([C@H]2c1c(O)cc(c2c1O[C@@H]([C@@H](C2)O)c1ccc(c(c1)O)O)O)O)O)O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Procyanidin C1 is a natural polyphenol, causes DNA damage, cell cycle arrest, and induces apoptosis. Procyanidin C1 decreases the level of Bcl-2, but enhances BAX, caspase 3 and 9 expression in cancer cells[1]. |
| Target | Apoptosis[1] |
| Density | 1.747g/cm3 |
| Exact Mass | 866.20600 |
| PSA | 331.14000 |
| LogP | 4.44390 |
| Storage condition | ?20°C |