Home
Products
Cyclo(L-Phe-L-Pro)
| Product Name | Cyclo(L-Phe-L-Pro) |
| Price: | Inquiry |
| Catalog No.: | CN01064 |
| CAS No.: | 3705-26-8 |
| Molecular Formula: | C14H16N2O2 |
| Molecular Weight: | 244.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Oil |
| Source: | From Phellinus igniarius |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1N[C@@H](Cc2ccccc2)C(=O)N2[C@H]1CCC2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cyclo(L-Phe-L-Pro), isolated from Pseudomonas fluorescens and Pseudomonas alcaligenes cell-free culture supernatants is an antifungal cyclic dipeptide[1]. Cyclo(L-Phe-L-Pro) inhibits IFN-β production by interfering with retinoic-acid-inducible gene-I (RIG-I) activation[2]. Cyclo(L-Phe-L-Pro) exhibits free-radical scavenging activity with the IC50 of 24 µM in the DPPH assay[3]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 509.5±39.0 °C at 760 mmHg |
| Flash Point | 262.0±27.1 °C |
| Exact Mass | 244.121185 |
| PSA | 49.41000 |
| LogP | -0.56 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | -15°C |