Home
Products
Oroxylin A 7-O-beta-D-glucuronide
| Product Name | Oroxylin A 7-O-beta-D-glucuronide |
| Price: | $117 / 10mg |
| Catalog No.: | CN05222 |
| CAS No.: | 36948-76-2 |
| Molecular Formula: | C22H20O11 |
| Molecular Weight: | 460.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Scutellaria regeliana Nakai |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1c(O[C@@H]2O[C@H](C(=O)O)[C@H]([C@@H]([C@H]2O)O)O)cc2c(c1O)c(=O)cc(o2)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Oroxylin A-7-O-glucuronide (Oroxyloside; Oroxylin A-7-O-β-D-glucuronide) is a flavonoid glucuronide isolated from the dried root of Scutellaria baicalensis, with prolyl oligopeptidase (POP) inhibitory activity[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 796.6±60.0 °C at 760 mmHg |
| Flash Point | 280.1±26.4 °C |
| Exact Mass | 460.100555 |
| PSA | 176.12000 |
| LogP | -0.42 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |