Home
Products
Aucuparin
| Product Name | Aucuparin |
| Price: | Inquiry |
| Catalog No.: | CN03570 |
| CAS No.: | 3687-28-3 |
| Molecular Formula: | C14H14O3 |
| Molecular Weight: | 230.26 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The stems of Pourthiaea lucida. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(cc(c1O)OC)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aucuparin, a natural product found in Sorbus aucuparia, inhibits pulmonary fibrosis in a bleomycin (BLM)-induced lung fibrosis mouse model. Anti-inflammatory activity[1][2]. |
| Density | 1.144g/cm3 |
| Boiling Point | 349.4ºC at 760 mmHg |
| Flash Point | 165.1ºC |
| Exact Mass | 230.09400 |
| PSA | 38.69000 |
| LogP | 3.07640 |