Home
Products
Daidzein diacetate
| Product Name | Daidzein diacetate |
| Price: | Inquiry |
| Catalog No.: | CN04509 |
| CAS No.: | 3682-01-7 |
| Molecular Formula: | C19H14O6 |
| Molecular Weight: | 338.31 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Pueraria lobata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)Oc1ccc(cc1)c1coc2c(c1=O)ccc(c2)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Daidzein diacetate is a derivative of Daidzein that is a soy isoflavone[1][2]. |
| Exact Mass | 338.07900 |
| PSA | 82.81000 |
| LogP | 3.31060 |