Home
Products
Vitexin
| Product Name | Vitexin |
| Price: | Inquiry |
| Catalog No.: | CN05387 |
| CAS No.: | 3681-93-4 |
| Molecular Formula: | C21H20O10 |
| Molecular Weight: | 432.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The seeds of Vitex trifolia L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(O)cc(c2c1oc(cc2=O)c1ccc(cc1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vitexin is a c-glycosylated flavone, and is found in various medicinal plants species such as Ficus deltoid and Spirodela polyrhiza. Vitexin has a wide range of pharmacological effects, including anti-oxidant, anti-cancer, anti-inflammatory, anti-hyperalgesic, and neuroprotective effects[1][2]. |
| In Vivo | Vitexin exerts neuroprotective effect against pentylenetetrazole-induced seizures, scopolamine-induced memory impairment, and glutamate-induced neuronal excitotoxicity[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 767.7±60.0 °C at 760 mmHg |
| Flash Point | 273.1±26.4 °C |
| Exact Mass | 432.105652 |
| PSA | 181.05000 |
| LogP | 1.28 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |