Home
Products
10-Shogaol
| Product Name | 10-Shogaol |
| Price: | $190 / 10mg |
| Catalog No.: | CN03892 |
| CAS No.: | 36752-54-2 |
| Molecular Formula: | C21H32O3 |
| Molecular Weight: | 332.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Oil |
| Source: | The rhizomes of Zingber officinale Rosc. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCCCCCC=CC(=O)CCc1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | [10]-Shogaol is an antioxidant from Zingiber officinale for human skin cell growth and a migration enhancer. [10]-Shogaol inhibits COX-2 with an IC50 of 7.5 μM and has antiproliferation activity[1][2][3]. |
| Target | COX-2:7.5 μM (IC50) |
| Exact Mass | 332.23500 |
| PSA | 46.53000 |
| LogP | 5.59940 |
| Storage condition | 2-8℃ |