Home
Products
8-Shogaol
| Product Name | 8-Shogaol |
| Price: | $190 / 10mg |
| Catalog No.: | CN03893 |
| CAS No.: | 36700-45-5 |
| Molecular Formula: | C19H28O3 |
| Molecular Weight: | 304.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Oil |
| Source: | The rhizomes of Zingber officinale Rosc. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCCCC=CC(=O)CCc1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | [8]-Shogaol, one of the pungent phenolic compounds in ginger, exhibits anti-platelet activity (IC50=5 μM) and inhibits COX-2 (IC50=17.5 μM). [8]-Shogaol induces apoptosis in human leukemia cells[1][2][3][4]. |
| Target | COX-2:17.5 μM (IC50) |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 452.3±35.0 °C at 760 mmHg |
| Flash Point | 154.6±19.4 °C |
| Exact Mass | 304.203857 |
| PSA | 46.53000 |
| LogP | 4.91 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |