Home
Products
Guaiacin
| Product Name | Guaiacin |
| Price: | $424 / 5mg |
| Catalog No.: | CN02926 |
| CAS No.: | 36531-08-5 |
| Molecular Formula: | C20H24O4 |
| Molecular Weight: | 328.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The Leaves of Guaiacum officinale. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CC(C)C(C(c2cc1O)c1ccc(c(c1)OC)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Guaiacin is a arylnaphthalene type lignin isolated from the barks of Machilus thunbergii SIEB. et ZUCC (Lauraceae). Guaiacin significantly increases alkaline phosphatase activity and osteoblast differentiation[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 484.5±45.0 °C at 760 mmHg |
| Flash Point | 246.8±28.7 °C |
| Exact Mass | 328.167450 |
| PSA | 58.92000 |
| LogP | 4.06 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |