Home
Products
Paprazine
| Product Name | Paprazine |
| Price: | $219 / 10mg |
| Catalog No.: | CN00817 |
| CAS No.: | 36417-86-4 |
| Molecular Formula: | C17H17NO3 |
| Molecular Weight: | 283.32 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Polygonum orientale. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(/C=C/c1ccc(cc1)O)NCCc1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | N-p-trans-Coumaroyltyramine is a cinnamoylphenethyl amide isolated from polygonum hyrcanicum, acts as an acetylcholinesterase (AChE) inhibitor with an an IC50 of 122 μM. N-p-trans-Coumaroyltyramine exhibits anti-trypanosomal activity with an IC50 of 13.3 µM for T. brucei rhodesiense[1][2]. |
| Target | IC50: 122 μM (AChE)[2] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 586.5±50.0 °C at 760 mmHg |
| Flash Point | 308.5±30.1 °C |
| Exact Mass | 283.120850 |
| PSA | 69.56000 |
| LogP | 2.24 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | 2-8℃ |