Home
Products
Columbamine
| Product Name | Columbamine |
| Price: | $117 / 10mg |
| Catalog No.: | CN01098 |
| CAS No.: | 3621-36-1 |
| Molecular Formula: | C20H20NO4 |
| Molecular Weight: | 338.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Coptis chinensis Franch |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CC[n+]3c(c2cc1O)cc1c(c3)c(OC)c(cc1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Columbamine is a quaternary isoquinoline alkaloid isolated from Argemone mexicana. |
| Exact Mass | 338.138672 |
| PSA | 51.80000 |
| LogP | -1.89 |
| Storage condition | -20°C |