Home
Products
Phytin
| Product Name | Phytin |
| Price: | $15 / 20mg |
| Catalog No.: | CN06708 |
| CAS No.: | 3615-82-5 |
| Molecular Formula: | C6H6Ca6O24P6 |
| Molecular Weight: | 888.42 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Oryza sativa |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | [O-]P(=O)(O[C@H]1[C@H](OP(=O)(O)[O-])[C@@H](OP(=O)(O)[O-])[C@@H]([C@H]([C@H]1OP(=O)(O)[O-])OP(=O)(O)O)OP(=O)(O)O)O.[Mg+2].[Ca+2] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Calcium Phytate is found in food and is significant for human nutrition[1]. |
| Target | Human Endogenous Metabolite |
| Density | 2.42g/cm3 |
| Boiling Point | 1190.7ºC at 760mmHg |
| Flash Point | 673.9ºC |
| Exact Mass | 887.543030 |
| PSA | 493.38000 |
| LogP | 2.12580 |